C44H46N2O6 — CID 6692073
N-[[3-[3-[(2R,4R,5S,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6692073) has the molecular formula C44H46N2O6 and a molecular weight of 698.86 g/mol. Its IUPAC name is N-[[3-[3-[(2R,4R,5S,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[3-[3-[(2R,4R,5S,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6692073 |
| Molecular Formula | C44H46N2O6 |
| Molecular Weight | 698.86 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | N-[[3-[3-[(2R,4R,5S,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | COc1cc2c(cc1OC)CN(C[C@@H]1O[C@H](c3cccc(-c4cccc(CNC(=O)c5ccccc5)c4)c3)O[C@H](c3ccc(CO)cc3)[C@@H]1C)CC2 |
| InChI | InChI=1S/C44H46N2O6/c1-29-41(27-46-20-19-36-23-39(49-2)40(50-3)24-38(36)26-46)51-44(52-42(29)32-17-15-30(28-47)16-18-32)37-14-8-13-35(22-37)34-12-7-9-31(21-34)25-45-43(48)33-10-5-4-6-11-33/h4-18,21-24,29,41-42,44,47H,19-20,25-28H2,1-3H3,(H,45,48)/t29-,41+,42+,44+/m1/s1 |
| InChIKey | LVHPZWDHUCLLAE-WQHXUNGZSA-N |
| XLogP | 7.64 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.86 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |