C40H44N2O7 — CID 6680359
N-(3-acetylphenyl)-2-[4-[(4S,5R,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6680359) has the molecular formula C40H44N2O7 and a molecular weight of 664.80 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[4-[(4S,5R,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[4-[(4S,5R,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6680359 |
| Molecular Formula | C40H44N2O7 |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 664.31 |
| IUPAC Name | N-(3-acetylphenyl)-2-[4-[(4S,5R,6R)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | COc1cc2c(cc1OC)CN(C[C@H]1OC(c3ccc(CC(=O)Nc4cccc(C(C)=O)c4)cc3)O[C@@H](c3ccc(CO)cc3)[C@H]1C)CC2 |
| InChI | InChI=1S/C40H44N2O7/c1-25-37(23-42-17-16-32-20-35(46-3)36(47-4)21-33(32)22-42)48-40(49-39(25)29-12-10-28(24-43)11-13-29)30-14-8-27(9-15-30)18-38(45)41-34-7-5-6-31(19-34)26(2)44/h5-15,19-21,25,37,39-40,43H,16-18,22-24H2,1-4H3,(H,41,45)/t25-,37+,39+,40?/m0/s1 |
| InChIKey | SZWOTSUGKFJMDR-KCUABOTKSA-N |
| XLogP | 6.43 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.80 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |