C43H45N3O7 — CID 6706027
1-[4-[(2R,4R,5S,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea (PubChem CID 6706027) has the molecular formula C43H45N3O7 and a molecular weight of 715.85 g/mol. Its IUPAC name is 1-[4-[(2R,4R,5S,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[4-[(2R,4R,5S,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 6706027 |
| Molecular Formula | C43H45N3O7 |
| Molecular Weight | 715.85 g/mol |
| Exact Mass | 715.33 |
| IUPAC Name | 1-[4-[(2R,4R,5S,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea |
| SMILES | COc1cc2c(cc1OC)CN(C[C@@H]1O[C@H](c3ccc(NC(=O)Nc4ccc(Oc5ccccc5)cc4)cc3)O[C@H](c3ccc(CO)cc3)[C@@H]1C)CC2 |
| InChI | InChI=1S/C43H45N3O7/c1-28-40(26-46-22-21-32-23-38(49-2)39(50-3)24-33(32)25-46)52-42(53-41(28)30-11-9-29(27-47)10-12-30)31-13-15-34(16-14-31)44-43(48)45-35-17-19-37(20-18-35)51-36-7-5-4-6-8-36/h4-20,23-24,28,40-42,47H,21-22,25-27H2,1-3H3,(H2,44,45,48)/t28-,40+,41+,42+/m1/s1 |
| InChIKey | QUNVXBVKQGEVSY-VCEYVUERSA-N |
| XLogP | 8.48 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.85 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |