C36H33F5N2O6 — CID 3445988
N-[4-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 3445988) has the molecular formula C36H33F5N2O6 and a molecular weight of 684.66 g/mol. Its IUPAC name is N-[4-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[4-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 3445988 |
| Molecular Formula | C36H33F5N2O6 |
| Molecular Weight | 684.66 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | N-[4-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | COc1cc2c(cc1OC)CN(CC1CC(c3ccc(CO)cc3)OC(c3ccc(NC(=O)c4c(F)c(F)c(F)c(F)c4F)cc3)O1)CC2 |
| InChI | InChI=1S/C36H33F5N2O6/c1-46-27-13-22-11-12-43(16-23(22)14-28(27)47-2)17-25-15-26(20-5-3-19(18-44)4-6-20)49-36(48-25)21-7-9-24(10-8-21)42-35(45)29-30(37)32(39)34(41)33(40)31(29)38/h3-10,13-14,25-26,36,44H,11-12,15-18H2,1-2H3,(H,42,45) |
| InChIKey | XSKBAJVOOCELFF-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.66 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|