C32H39N3O6 — CID 6708131
1-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-3-ethylurea (PubChem CID 6708131) has the molecular formula C32H39N3O6 and a molecular weight of 561.68 g/mol. Its IUPAC name is 1-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-3-ethylurea.
| Compound Name | 1-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 6708131 |
| Molecular Formula | C32H39N3O6 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | 1-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc([C@H]2O[C@@H](CN3CCc4cc(OC)c(OC)cc4C3)C[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C32H39N3O6/c1-4-33-32(37)34-26-11-9-23(10-12-26)31-40-27(17-28(41-31)22-7-5-21(20-36)6-8-22)19-35-14-13-24-15-29(38-2)30(39-3)16-25(24)18-35/h5-12,15-16,27-28,31,36H,4,13-14,17-20H2,1-3H3,(H2,33,34,37)/t27-,28+,31+/m1/s1 |
| InChIKey | MBJYFBXRBRURET-XHWIWGEHSA-N |
| XLogP | 4.94 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |