C41H48N4O7 — CID 6675232
N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide (PubChem CID 6675232) has the molecular formula C41H48N4O7 and a molecular weight of 708.86 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 6675232 |
| Molecular Formula | C41H48N4O7 |
| Molecular Weight | 708.86 g/mol |
| Exact Mass | 708.35 |
| IUPAC Name | N'-(2-aminophenyl)-N-[[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]pentanediamide |
| SMILES | COc1cc2c(cc1OC)CN(C[C@H]1C[C@@H](c3ccc(CO)cc3)O[C@@H](c3ccc(CNC(=O)CCCC(=O)Nc4ccccc4N)cc3)O1)CC2 |
| InChI | InChI=1S/C41H48N4O7/c1-49-37-20-31-18-19-45(24-32(31)21-38(37)50-2)25-33-22-36(29-14-12-28(26-46)13-15-29)52-41(51-33)30-16-10-27(11-17-30)23-43-39(47)8-5-9-40(48)44-35-7-4-3-6-34(35)42/h3-4,6-7,10-17,20-21,33,36,41,46H,5,8-9,18-19,22-26,42H2,1-2H3,(H,43,47)(H,44,48)/t33-,36+,41+/m1/s1 |
| InChIKey | BLIBAWQUTWSCSG-ACSGNZHVSA-N |
| XLogP | 5.81 |
| TPSA | 144.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.86 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|