C43H50N2O8 — CID 6675260
7-[[2-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid (PubChem CID 6675260) has the molecular formula C43H50N2O8 and a molecular weight of 722.88 g/mol. Its IUPAC name is 7-[[2-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid.
| Compound Name | 7-[[2-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 6675260 |
| Molecular Formula | C43H50N2O8 |
| Molecular Weight | 722.88 g/mol |
| Exact Mass | 722.36 |
| IUPAC Name | 7-[[2-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-7-oxoheptanoic acid |
| SMILES | COc1cc2c(cc1OC)CN(C[C@H]1C[C@@H](c3ccc(CO)cc3)O[C@@H](c3ccc(-c4ccccc4CNC(=O)CCCCCC(=O)O)cc3)O1)CC2 |
| InChI | InChI=1S/C43H50N2O8/c1-50-39-22-33-20-21-45(26-35(33)23-40(39)51-2)27-36-24-38(31-14-12-29(28-46)13-15-31)53-43(52-36)32-18-16-30(17-19-32)37-9-7-6-8-34(37)25-44-41(47)10-4-3-5-11-42(48)49/h6-9,12-19,22-23,36,38,43,46H,3-5,10-11,20-21,24-28H2,1-2H3,(H,44,47)(H,48,49)/t36-,38+,43+/m1/s1 |
| InChIKey | OMRRTLQKEVWUSL-DBBBTHBISA-N |
| XLogP | 7.12 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.88 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|