C44H42N2O7 — CID 6703095
2-[[2-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6703095) has the molecular formula C44H42N2O7 and a molecular weight of 710.83 g/mol. Its IUPAC name is 2-[[2-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6703095 |
| Molecular Formula | C44H42N2O7 |
| Molecular Weight | 710.83 g/mol |
| Exact Mass | 710.30 |
| IUPAC Name | 2-[[2-[4-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | COc1cc2c(cc1OC)CN(C[C@H]1C[C@@H](c3ccc(CO)cc3)O[C@@H](c3ccc(-c4ccccc4CN4C(=O)c5ccccc5C4=O)cc3)O1)CC2 |
| InChI | InChI=1S/C44H42N2O7/c1-50-40-21-32-19-20-45(24-34(32)22-41(40)51-2)26-35-23-39(30-13-11-28(27-47)12-14-30)53-44(52-35)31-17-15-29(16-18-31)36-8-4-3-7-33(36)25-46-42(48)37-9-5-6-10-38(37)43(46)49/h3-18,21-22,35,39,44,47H,19-20,23-27H2,1-2H3/t35-,39+,44+/m1/s1 |
| InChIKey | XPUCKHIVQVKDLI-SFXXTGOWSA-N |
| XLogP | 7.26 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.83 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|