C38H37F5N2O5 — CID 3667778
2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 3667778) has the molecular formula C38H37F5N2O5 and a molecular weight of 696.71 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 3667778 |
| Molecular Formula | C38H37F5N2O5 |
| Molecular Weight | 696.71 g/mol |
| Exact Mass | 696.26 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-6-[[2-(methoxymethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | COCC1CCCN1CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3ccccc3CNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O1 |
| InChI | InChI=1S/C38H37F5N2O5/c1-48-21-27-6-4-16-45(27)19-28-17-30(24-10-8-22(20-46)9-11-24)50-38(49-28)25-14-12-23(13-15-25)29-7-3-2-5-26(29)18-44-37(47)31-32(39)34(41)36(43)35(42)33(31)40/h2-3,5,7-15,27-28,30,38,46H,4,6,16-21H2,1H3,(H,44,47) |
| InChIKey | FVKCTIRMLXZMTR-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|