C33H30F5N5O4 — CID 4104679
2,3,4,5,6-pentafluoro-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 4104679) has the molecular formula C33H30F5N5O4 and a molecular weight of 655.62 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 4104679 |
| Molecular Formula | C33H30F5N5O4 |
| Molecular Weight | 655.62 g/mol |
| Exact Mass | 655.22 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C2OC(CN3CCN(c4ncccn4)CC3)CC(c3ccc(CO)cc3)O2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C33H30F5N5O4/c34-26-25(27(35)29(37)30(38)28(26)36)31(45)41-22-8-6-21(7-9-22)32-46-23(16-24(47-32)20-4-2-19(18-44)3-5-20)17-42-12-14-43(15-13-42)33-39-10-1-11-40-33/h1-11,23-24,32,44H,12-18H2,(H,41,45) |
| InChIKey | RITLAIWITWUNGK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|