C28H30Cl3N5O4 — CID 6706837
2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6706837) has the molecular formula C28H30Cl3N5O4 and a molecular weight of 606.94 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6706837 |
| Molecular Formula | C28H30Cl3N5O4 |
| Molecular Weight | 606.94 g/mol |
| Exact Mass | 605.14 |
| IUPAC Name | 2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | O=C(Nc1ccc([C@@H]2O[C@H](CN3CCN(c4ncccn4)CC3)C[C@H](c3ccc(CO)cc3)O2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C28H30Cl3N5O4/c29-28(30,31)26(38)34-22-8-6-21(7-9-22)25-39-23(16-24(40-25)20-4-2-19(18-37)3-5-20)17-35-12-14-36(15-13-35)27-32-10-1-11-33-27/h1-11,23-25,37H,12-18H2,(H,34,38)/t23-,24+,25+/m0/s1 |
| InChIKey | LZDZSPBEEDHIBW-ISJGIBHGSA-N |
| XLogP | 4.65 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|