C40H32N2O5S2 — CID 6702237
2-[[3-[3-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6702237) has the molecular formula C40H32N2O5S2 and a molecular weight of 684.84 g/mol. Its IUPAC name is 2-[[3-[3-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[3-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6702237 |
| Molecular Formula | C40H32N2O5S2 |
| Molecular Weight | 684.84 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | 2-[[3-[3-[(2R,4R,6S)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cccc(-c2cccc([C@H]3O[C@@H](CSc4nc5ccccc5s4)C[C@@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C40H32N2O5S2/c43-23-25-15-17-27(18-16-25)35-21-31(24-48-40-41-34-13-3-4-14-36(34)49-40)46-39(47-35)30-10-6-9-29(20-30)28-8-5-7-26(19-28)22-42-37(44)32-11-1-2-12-33(32)38(42)45/h1-20,31,35,39,43H,21-24H2/t31-,35+,39+/m1/s1 |
| InChIKey | GZMDZFWPPYSQPY-UKRPZDILSA-N |
| XLogP | 8.59 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.84 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|