C33H28N2O8S — CID 6679590
N-[[4-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]-1,3-dioxo-2-benzofuran-5-carboxamide (PubChem CID 6679590) has the molecular formula C33H28N2O8S and a molecular weight of 612.66 g/mol. Its IUPAC name is N-[[4-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]-1,3-dioxo-2-benzofuran-5-carboxamide.
| Compound Name | N-[[4-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 6679590 |
| Molecular Formula | C33H28N2O8S |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | N-[[4-[(4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
| SMILES | O=C(NCc1ccc(C2O[C@H](CSc3cccc[n+]3[O-])C[C@H](c3ccc(CO)cc3)O2)cc1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C33H28N2O8S/c36-18-21-6-8-22(9-7-21)28-16-25(19-44-29-3-1-2-14-35(29)40)41-33(42-28)23-10-4-20(5-11-23)17-34-30(37)24-12-13-26-27(15-24)32(39)43-31(26)38/h1-15,25,28,33,36H,16-19H2,(H,34,37)/t25-,28+,33?/m0/s1 |
| InChIKey | IRXFCNAWVRXBLV-FLLLVALTSA-N |
| XLogP | 4.39 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|