C35H41N3O5S — CID 6700528
1-(1-adamantyl)-3-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea (PubChem CID 6700528) has the molecular formula C35H41N3O5S and a molecular weight of 615.80 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6700528 |
| Molecular Formula | C35H41N3O5S |
| Molecular Weight | 615.80 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | 1-(1-adamantyl)-3-[[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc([C@H]2O[C@@H](CSc3cccc[n+]3[O-])C[C@@H](c3ccc(CO)cc3)O2)cc1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C35H41N3O5S/c39-21-24-6-8-28(9-7-24)31-16-30(22-44-32-3-1-2-12-38(32)41)42-33(43-31)29-10-4-23(5-11-29)20-36-34(40)37-35-17-25-13-26(18-35)15-27(14-25)19-35/h1-12,25-27,30-31,33,39H,13-22H2,(H2,36,37,40)/t25?,26?,27?,30-,31+,33+,35?/m1/s1 |
| InChIKey | MJMILSIZZAIQQD-RRZZLRPLSA-N |
| XLogP | 5.92 |
| TPSA | 106.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.80 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|