C42H47N3O5S — CID 5091631
1-(1-adamantyl)-3-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 5091631) has the molecular formula C42H47N3O5S and a molecular weight of 705.92 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 5091631 |
| Molecular Formula | C42H47N3O5S |
| Molecular Weight | 705.92 g/mol |
| Exact Mass | 705.32 |
| IUPAC Name | 1-(1-adamantyl)-3-[[3-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | CC1C(CSc2cccc[n+]2[O-])OC(c2ccc(-c3cccc(CNC(=O)NC45CC6CC(CC(C6)C4)C5)c3)cc2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C42H47N3O5S/c1-27-37(26-51-38-7-2-3-16-45(38)48)49-40(50-39(27)34-10-8-28(25-46)9-11-34)35-14-12-33(13-15-35)36-6-4-5-29(20-36)24-43-41(47)44-42-21-30-17-31(22-42)19-32(18-30)23-42/h2-16,20,27,30-32,37,39-40,46H,17-19,21-26H2,1H3,(H2,43,44,47) |
| InChIKey | HXGYKDVSHUOROG-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 106.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.92 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|