C39H39N3O5S — CID 6683658
1-benzyl-3-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6683658) has the molecular formula C39H39N3O5S and a molecular weight of 661.82 g/mol. Its IUPAC name is 1-benzyl-3-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6683658 |
| Molecular Formula | C39H39N3O5S |
| Molecular Weight | 661.82 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | 1-benzyl-3-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CNC(=O)NCc4ccccc4)c3)cc2)O[C@@H]1CSc1cccc[n+]1[O-] |
| InChI | InChI=1S/C39H39N3O5S/c1-27-35(26-48-36-12-5-6-21-42(36)45)46-38(47-37(27)32-15-13-29(25-43)14-16-32)33-19-17-31(18-20-33)34-11-7-10-30(22-34)24-41-39(44)40-23-28-8-3-2-4-9-28/h2-22,27,35,37-38,43H,23-26H2,1H3,(H2,40,41,44)/t27-,35+,37?,38+/m0/s1 |
| InChIKey | VUFMGTKIGGOXCQ-SCISGYQFSA-N |
| XLogP | 7.06 |
| TPSA | 106.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.82 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|