C27H27Cl3N2O5S — CID 6689359
2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide (PubChem CID 6689359) has the molecular formula C27H27Cl3N2O5S and a molecular weight of 597.95 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6689359 |
| Molecular Formula | C27H27Cl3N2O5S |
| Molecular Weight | 597.95 g/mol |
| Exact Mass | 596.07 |
| IUPAC Name | 2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)C(Cl)(Cl)Cl)cc2)O[C@H]1CSc1cccc[n+]1[O-] |
| InChI | InChI=1S/C27H27Cl3N2O5S/c1-17-22(16-38-23-4-2-3-13-32(23)35)36-25(37-24(17)20-9-7-19(15-33)8-10-20)21-11-5-18(6-12-21)14-31-26(34)27(28,29)30/h2-13,17,22,24-25,33H,14-16H2,1H3,(H,31,34)/t17-,22+,24?,25+/m1/s1 |
| InChIKey | URPDXKBJRWQCIB-LVUUHUFRSA-N |
| XLogP | 5.38 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|