C33H30N4O5S — CID 4080871
N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide (PubChem CID 4080871) has the molecular formula C33H30N4O5S and a molecular weight of 594.69 g/mol. Its IUPAC name is N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide.
| Compound Name | N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 4080871 |
| Molecular Formula | C33H30N4O5S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | N-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
| SMILES | CC1C(CSc2cccc[n+]2[O-])OC(c2ccc(NC(=O)c3cnc4ccccc4n3)cc2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C33H30N4O5S/c1-21-29(20-43-30-8-4-5-17-37(30)40)41-33(42-31(21)23-11-9-22(19-38)10-12-23)24-13-15-25(16-14-24)35-32(39)28-18-34-26-6-2-3-7-27(26)36-28/h2-18,21,29,31,33,38H,19-20H2,1H3,(H,35,39) |
| InChIKey | FUCSFXXVGRNTKF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|