C29H32N2O7S — CID 6705514
5-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid (PubChem CID 6705514) has the molecular formula C29H32N2O7S and a molecular weight of 552.65 g/mol. Its IUPAC name is 5-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid.
| Compound Name | 5-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6705514 |
| Molecular Formula | C29H32N2O7S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 5-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(NC(=O)CCCC(=O)O)cc2)O[C@H]1CSc1cccc[n+]1[O-] |
| InChI | InChI=1S/C29H32N2O7S/c1-19-24(18-39-26-6-2-3-16-31(26)36)37-29(38-28(19)21-10-8-20(17-32)9-11-21)22-12-14-23(15-13-22)30-25(33)5-4-7-27(34)35/h2-3,6,8-16,19,24,28-29,32H,4-5,7,17-18H2,1H3,(H,30,33)(H,34,35)/t19-,24+,28?,29+/m1/s1 |
| InChIKey | OPRUSTXAVSBHMP-ZIYNXMTISA-N |
| XLogP | 4.59 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|