C33H35N3O5S — CID 3522527
1-ethyl-3-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]methyl]urea (PubChem CID 3522527) has the molecular formula C33H35N3O5S and a molecular weight of 585.73 g/mol. Its IUPAC name is 1-ethyl-3-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 3522527 |
| Molecular Formula | C33H35N3O5S |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | 1-ethyl-3-[[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]methyl]urea |
| SMILES | CCNC(=O)NCc1ccc(C2OC(CSc3cccc[n+]3[O-])C(c3ccccc3)C(c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C33H35N3O5S/c1-2-34-33(38)35-20-23-11-17-27(18-12-23)32-40-28(22-42-29-10-6-7-19-36(29)39)30(25-8-4-3-5-9-25)31(41-32)26-15-13-24(21-37)14-16-26/h3-19,28,30-32,37H,2,20-22H2,1H3,(H2,34,35,38) |
| InChIKey | HNIYALNBRXYVQF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 106.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|