C43H39N3O6S — CID 6695099
1-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea (PubChem CID 6695099) has the molecular formula C43H39N3O6S and a molecular weight of 725.87 g/mol. Its IUPAC name is 1-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 6695099 |
| Molecular Formula | C43H39N3O6S |
| Molecular Weight | 725.87 g/mol |
| Exact Mass | 725.26 |
| IUPAC Name | 1-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
| SMILES | O=C(NCc1cccc(-c2cccc([C@@H]3O[C@H](CSc4cccc[n+]4[O-])C[C@H](c4ccc(CO)cc4)O3)c2)c1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C43H39N3O6S/c47-28-30-15-17-32(18-16-30)40-26-39(29-53-41-14-4-5-23-46(41)49)51-42(52-40)35-11-7-10-34(25-35)33-9-6-8-31(24-33)27-44-43(48)45-36-19-21-38(22-20-36)50-37-12-2-1-3-13-37/h1-25,39-40,42,47H,26-29H2,(H2,44,45,48)/t39-,40+,42+/m0/s1 |
| InChIKey | QOHCYUTVVYXJDJ-MQFHWOLUSA-N |
| XLogP | 8.93 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.87 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|