C54H69N3O5 — CID 6703893
1-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea (PubChem CID 6703893) has the molecular formula C54H69N3O5 and a molecular weight of 840.16 g/mol. Its IUPAC name is 1-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 6703893 |
| Molecular Formula | C54H69N3O5 |
| Molecular Weight | 840.16 g/mol |
| Exact Mass | 839.52 |
| IUPAC Name | 1-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-3-(4-phenoxyphenyl)urea |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)Nc4ccc(Oc5ccccc5)cc4)c3)c2)O1 |
| InChI | InChI=1S/C54H69N3O5/c1-3-5-7-9-11-16-34-57(35-17-12-10-8-6-4-2)40-51-38-52(44-28-26-42(41-58)27-29-44)62-53(61-51)47-23-19-22-46(37-47)45-21-18-20-43(36-45)39-55-54(59)56-48-30-32-50(33-31-48)60-49-24-14-13-15-25-49/h13-15,18-33,36-37,51-53,58H,3-12,16-17,34-35,38-41H2,1-2H3,(H2,55,56,59)/t51-,52+,53+/m1/s1 |
| InChIKey | IHGKNWNTZYILMI-IKNGHIENSA-N |
| XLogP | 13.53 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.16 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|