C33H40N4O4S2 — CID 6705544
1-(1-adamantyl)-3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6705544) has the molecular formula C33H40N4O4S2 and a molecular weight of 620.84 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6705544 |
| Molecular Formula | C33H40N4O4S2 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | 1-(1-adamantyl)-3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | Cc1nnc(SC[C@@H]2O[C@H](c3ccc(NC(=O)NC45CC6CC(CC(C6)C4)C5)cc3)O[C@H](c3ccc(CO)cc3)[C@@H]2C)s1 |
| InChI | InChI=1S/C33H40N4O4S2/c1-19-28(18-42-32-37-36-20(2)43-32)40-30(41-29(19)25-5-3-21(17-38)4-6-25)26-7-9-27(10-8-26)34-31(39)35-33-14-22-11-23(15-33)13-24(12-22)16-33/h3-10,19,22-24,28-30,38H,11-18H2,1-2H3,(H2,34,35,39)/t19-,22?,23?,24?,28+,29+,30+,33?/m1/s1 |
| InChIKey | JIHXXBDWACEMJM-LVFDRWANSA-N |
| XLogP | 7.01 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |