C35H41N3O4S — CID 6682464
1-(1-adamantyl)-3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6682464) has the molecular formula C35H41N3O4S and a molecular weight of 599.80 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6682464 |
| Molecular Formula | C35H41N3O4S |
| Molecular Weight | 599.80 g/mol |
| Exact Mass | 599.28 |
| IUPAC Name | 1-(1-adamantyl)-3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | C[C@H]1[C@@H](CSc2ccccn2)O[C@@H](c2cccc(NC(=O)NC34CC5CC(CC(C5)C3)C4)c2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H41N3O4S/c1-22-30(21-43-31-7-2-3-12-36-31)41-33(42-32(22)27-10-8-23(20-39)9-11-27)28-5-4-6-29(16-28)37-34(40)38-35-17-24-13-25(18-35)15-26(14-24)19-35/h2-12,16,22,24-26,30,32-33,39H,13-15,17-21H2,1H3,(H2,37,38,40)/t22-,24?,25?,26?,30+,32+,33+,35?/m0/s1 |
| InChIKey | MLATWSWRTDORHM-OUHVYSCXSA-N |
| XLogP | 7.25 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.80 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |