C52H75N3O4 — CID 4168808
1-(1-adamantyl)-3-[[2-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 4168808) has the molecular formula C52H75N3O4 and a molecular weight of 806.19 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[2-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[2-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 4168808 |
| Molecular Formula | C52H75N3O4 |
| Molecular Weight | 806.19 g/mol |
| Exact Mass | 805.58 |
| IUPAC Name | 1-(1-adamantyl)-3-[[2-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | CCCCCCCCN(CCCCCCCC)CC1CC(c2ccc(CO)cc2)OC(c2ccc(-c3ccccc3CNC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O1 |
| InChI | InChI=1S/C52H75N3O4/c1-3-5-7-9-11-15-27-55(28-16-12-10-8-6-4-2)37-47-32-49(44-21-19-39(38-56)20-22-44)59-50(58-47)45-25-23-43(24-26-45)48-18-14-13-17-46(48)36-53-51(57)54-52-33-40-29-41(34-52)31-42(30-40)35-52/h13-14,17-26,40-42,47,49-50,56H,3-12,15-16,27-38H2,1-2H3,(H2,53,54,57) |
| InChIKey | JKZLBFFCAWRUQE-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.19 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|