C45H69N3O4 — CID 3690144
1-(1-adamantyl)-3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 3690144) has the molecular formula C45H69N3O4 and a molecular weight of 716.06 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 3690144 |
| Molecular Formula | C45H69N3O4 |
| Molecular Weight | 716.06 g/mol |
| Exact Mass | 715.53 |
| IUPAC Name | 1-(1-adamantyl)-3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | CCCCCCCCN(CCCCCCCC)CC1CC(c2ccc(CO)cc2)OC(c2ccc(NC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O1 |
| InChI | InChI=1S/C45H69N3O4/c1-3-5-7-9-11-13-23-48(24-14-12-10-8-6-4-2)32-41-28-42(38-17-15-34(33-49)16-18-38)52-43(51-41)39-19-21-40(22-20-39)46-44(50)47-45-29-35-25-36(30-45)27-37(26-35)31-45/h15-22,35-37,41-43,49H,3-14,23-33H2,1-2H3,(H2,46,47,50) |
| InChIKey | QFHIPWJKKPDWQR-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.06 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|