C43H69N3O5 — CID 6703823
6-acetamido-N-[[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanamide (PubChem CID 6703823) has the molecular formula C43H69N3O5 and a molecular weight of 708.04 g/mol. Its IUPAC name is 6-acetamido-N-[[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6703823 |
| Molecular Formula | C43H69N3O5 |
| Molecular Weight | 708.04 g/mol |
| Exact Mass | 707.52 |
| IUPAC Name | 6-acetamido-N-[[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)CCCCCNC(C)=O)cc2)O1 |
| InChI | InChI=1S/C43H69N3O5/c1-4-6-8-10-12-17-29-46(30-18-13-11-9-7-5-2)33-40-31-41(38-24-22-37(34-47)23-25-38)51-43(50-40)39-26-20-36(21-27-39)32-45-42(49)19-15-14-16-28-44-35(3)48/h20-27,40-41,43,47H,4-19,28-34H2,1-3H3,(H,44,48)(H,45,49)/t40-,41+,43+/m1/s1 |
| InChIKey | ZTAPRPFYWZHAPU-JWZYOJHJSA-N |
| XLogP | 9.06 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.04 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|