C31H43N3O5 — CID 6693050
6-acetamido-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanamide (PubChem CID 6693050) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is 6-acetamido-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6693050 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | 6-acetamido-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl(prop-2-enyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]hexanamide |
| SMILES | C=CCN(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(CNC(=O)CCCCCNC(C)=O)cc2)O1 |
| InChI | InChI=1S/C31H43N3O5/c1-4-18-34(3)21-28-19-29(26-13-11-25(22-35)12-14-26)39-31(38-28)27-15-9-24(10-16-27)20-33-30(37)8-6-5-7-17-32-23(2)36/h4,9-16,28-29,31,35H,1,5-8,17-22H2,2-3H3,(H,32,36)(H,33,37)/t28-,29+,31+/m0/s1 |
| InChIKey | ZHSMJCDIHWGTRS-ILJQZKEFSA-N |
| XLogP | 4.15 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|