C41H49N3O5 — CID 4614347
6-acetamido-N-[[3-[4-[4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 4614347) has the molecular formula C41H49N3O5 and a molecular weight of 663.86 g/mol. Its IUPAC name is 6-acetamido-N-[[3-[4-[4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[3-[4-[4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 4614347 |
| Molecular Formula | C41H49N3O5 |
| Molecular Weight | 663.86 g/mol |
| Exact Mass | 663.37 |
| IUPAC Name | 6-acetamido-N-[[3-[4-[4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1cccc(-c2ccc(C3OC(CN(C)Cc4ccccc4)CC(c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C41H49N3O5/c1-30(46)42-23-8-4-7-14-40(47)43-26-33-12-9-13-37(24-33)34-19-21-36(22-20-34)41-48-38(28-44(2)27-31-10-5-3-6-11-31)25-39(49-41)35-17-15-32(29-45)16-18-35/h3,5-6,9-13,15-22,24,38-39,41,45H,4,7-8,14,23,25-29H2,1-2H3,(H,42,46)(H,43,47) |
| InChIKey | HORKWRCUVJCOMF-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.86 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|