C49H73N3O5 — CID 6703889
6-acetamido-N-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 6703889) has the molecular formula C49H73N3O5 and a molecular weight of 784.14 g/mol. Its IUPAC name is 6-acetamido-N-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6703889 |
| Molecular Formula | C49H73N3O5 |
| Molecular Weight | 784.14 g/mol |
| Exact Mass | 783.56 |
| IUPAC Name | 6-acetamido-N-[[3-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(-c3cccc(CNC(=O)CCCCCNC(C)=O)c3)c2)O1 |
| InChI | InChI=1S/C49H73N3O5/c1-4-6-8-10-12-17-31-52(32-18-13-11-9-7-5-2)37-46-35-47(42-28-26-40(38-53)27-29-42)57-49(56-46)45-24-20-23-44(34-45)43-22-19-21-41(33-43)36-51-48(55)25-15-14-16-30-50-39(3)54/h19-24,26-29,33-34,46-47,49,53H,4-18,25,30-32,35-38H2,1-3H3,(H,50,54)(H,51,55)/t46-,47+,49+/m1/s1 |
| InChIKey | DZVBOZHRVIFCHW-CUCDLIAJSA-N |
| XLogP | 10.73 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.14 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|