C45H64N2O6 — CID 6703864
4-[[2-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 6703864) has the molecular formula C45H64N2O6 and a molecular weight of 729.01 g/mol. Its IUPAC name is 4-[[2-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[2-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6703864 |
| Molecular Formula | C45H64N2O6 |
| Molecular Weight | 729.01 g/mol |
| Exact Mass | 728.48 |
| IUPAC Name | 4-[[2-[4-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)CCC(=O)O)cc2)O1 |
| InChI | InChI=1S/C45H64N2O6/c1-3-5-7-9-11-15-29-47(30-16-12-10-8-6-4-2)33-40-31-42(37-21-19-35(34-48)20-22-37)53-45(52-40)38-25-23-36(24-26-38)41-18-14-13-17-39(41)32-46-43(49)27-28-44(50)51/h13-14,17-26,40,42,45,48H,3-12,15-16,27-34H2,1-2H3,(H,46,49)(H,50,51)/t40-,42+,45+/m1/s1 |
| InChIKey | QGOAJYZPPQJXRZ-PRZCARSJSA-N |
| XLogP | 9.90 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.01 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|