C26H27N3O3 — CID 4549274
[4-[2-(3-aminophenyl)-6-(benzimidazol-1-ylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 4549274) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is [4-[2-(3-aminophenyl)-6-(benzimidazol-1-ylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[2-(3-aminophenyl)-6-(benzimidazol-1-ylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 4549274 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | [4-[2-(3-aminophenyl)-6-(benzimidazol-1-ylmethyl)-5-methyl-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | CC1C(Cn2cnc3ccccc32)OC(c2cccc(N)c2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-17-24(14-29-16-28-22-7-2-3-8-23(22)29)31-26(20-5-4-6-21(27)13-20)32-25(17)19-11-9-18(15-30)10-12-19/h2-13,16-17,24-26,30H,14-15,27H2,1H3 |
| InChIKey | INMXQEKXTURWHK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|