C30H31N3O6 — CID 6689001
4-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid (PubChem CID 6689001) has the molecular formula C30H31N3O6 and a molecular weight of 529.59 g/mol. Its IUPAC name is 4-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6689001 |
| Molecular Formula | C30H31N3O6 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 4-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid |
| SMILES | C[C@@H]1[C@H](Cn2cnc3ccccc32)O[C@H](c2cccc(NC(=O)CCC(=O)O)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C30H31N3O6/c1-19-26(16-33-18-31-24-7-2-3-8-25(24)33)38-30(39-29(19)21-11-9-20(17-34)10-12-21)22-5-4-6-23(15-22)32-27(35)13-14-28(36)37/h2-12,15,18-19,26,29-30,34H,13-14,16-17H2,1H3,(H,32,35)(H,36,37)/t19-,26+,29+,30+/m1/s1 |
| InChIKey | OSYIBBXISIUZSO-QCJPAQFUSA-N |
| XLogP | 4.82 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |