C27H29Cl2N3O6 — CID 6683948
5-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid (PubChem CID 6683948) has the molecular formula C27H29Cl2N3O6 and a molecular weight of 562.45 g/mol. Its IUPAC name is 5-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid.
| Compound Name | 5-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6683948 |
| Molecular Formula | C27H29Cl2N3O6 |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | 5-[3-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)CCCC(=O)O)c2)O[C@@H]1Cn1cnc(Cl)c1Cl |
| InChI | InChI=1S/C27H29Cl2N3O6/c1-16-21(13-32-15-30-25(28)26(32)29)37-27(38-24(16)18-10-8-17(14-33)9-11-18)19-4-2-5-20(12-19)31-22(34)6-3-7-23(35)36/h2,4-5,8-12,15-16,21,24,27,33H,3,6-7,13-14H2,1H3,(H,31,34)(H,35,36)/t16-,21+,24?,27+/m0/s1 |
| InChIKey | JZSWFGWWSXKTGW-DSRCCCDPSA-N |
| XLogP | 5.37 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |