C27H29Cl2N3O6 — CID 6689714
4-[[4-[(2R,4R,5S,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 6689714) has the molecular formula C27H29Cl2N3O6 and a molecular weight of 562.45 g/mol. Its IUPAC name is 4-[[4-[(2R,4R,5S,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[4-[(2R,4R,5S,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6689714 |
| Molecular Formula | C27H29Cl2N3O6 |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | 4-[[4-[(2R,4R,5S,6S)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)CCC(=O)O)cc2)O[C@H]1Cn1cnc(Cl)c1Cl |
| InChI | InChI=1S/C27H29Cl2N3O6/c1-16-21(13-32-15-31-25(28)26(32)29)37-27(38-24(16)19-6-4-18(14-33)5-7-19)20-8-2-17(3-9-20)12-30-22(34)10-11-23(35)36/h2-9,15-16,21,24,27,33H,10-14H2,1H3,(H,30,34)(H,35,36)/t16-,21+,24?,27+/m1/s1 |
| InChIKey | PCCMWELEFVDWBG-VRHADHOUSA-N |
| XLogP | 4.65 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |