C32H29Cl2N5O4 — CID 6683967
N-[[4-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]quinoxaline-2-carboxamide (PubChem CID 6683967) has the molecular formula C32H29Cl2N5O4 and a molecular weight of 618.52 g/mol. Its IUPAC name is N-[[4-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[4-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6683967 |
| Molecular Formula | C32H29Cl2N5O4 |
| Molecular Weight | 618.52 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | N-[[4-[(2S,4S,5R,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]quinoxaline-2-carboxamide |
| SMILES | C[C@H]1[C@@H](Cn2cnc(Cl)c2Cl)O[C@@H](c2ccc(CNC(=O)c3cnc4ccccc4n3)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C32H29Cl2N5O4/c1-19-27(16-39-18-37-29(33)30(39)34)42-32(43-28(19)22-10-8-21(17-40)9-11-22)23-12-6-20(7-13-23)14-36-31(41)26-15-35-24-4-2-3-5-25(24)38-26/h2-13,15,18-19,27-28,32,40H,14,16-17H2,1H3,(H,36,41)/t19-,27+,28+,32+/m0/s1 |
| InChIKey | ZVGLVLNDGWYPEJ-AWYSFJJOSA-N |
| XLogP | 6.05 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |