C37H37N3O5S — CID 6687460
N-[[2-[4-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide (PubChem CID 6687460) has the molecular formula C37H37N3O5S and a molecular weight of 635.79 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[2-[4-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6687460 |
| Molecular Formula | C37H37N3O5S |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | N-[[2-[4-[(2R,4R,5S,6S)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
| SMILES | C[C@@H]1[C@H](CSCCO)O[C@H](c2ccc(-c3ccccc3CNC(=O)c3cnc4ccccc4n3)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C37H37N3O5S/c1-24-34(23-46-19-18-41)44-37(45-35(24)27-12-10-25(22-42)11-13-27)28-16-14-26(15-17-28)30-7-3-2-6-29(30)20-39-36(43)33-21-38-31-8-4-5-9-32(31)40-33/h2-17,21,24,34-35,37,41-42H,18-20,22-23H2,1H3,(H,39,43)/t24-,34+,35+,37+/m1/s1 |
| InChIKey | BKVAHIWVYNTPPS-TWDTVJDVSA-N |
| XLogP | 6.24 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|