C40H36N4O4S — CID 6688240
N-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide (PubChem CID 6688240) has the molecular formula C40H36N4O4S and a molecular weight of 668.82 g/mol. Its IUPAC name is N-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6688240 |
| Molecular Formula | C40H36N4O4S |
| Molecular Weight | 668.82 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | N-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
| SMILES | C[C@@H]1[C@H](CSc2ccccn2)O[C@H](c2ccc(-c3cccc(CNC(=O)c4cnc5ccccc5n4)c3)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C40H36N4O4S/c1-26-36(25-49-37-11-4-5-20-41-37)47-40(48-38(26)30-14-12-27(24-45)13-15-30)31-18-16-29(17-19-31)32-8-6-7-28(21-32)22-43-39(46)35-23-42-33-9-2-3-10-34(33)44-35/h2-21,23,26,36,38,40,45H,22,24-25H2,1H3,(H,43,46)/t26-,36+,38+,40+/m1/s1 |
| InChIKey | PIFZMJALLJYGHN-BPDJNETESA-N |
| XLogP | 7.70 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.82 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |