C37H35N7O4S — CID 6683185
N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide (PubChem CID 6683185) has the molecular formula C37H35N7O4S and a molecular weight of 673.80 g/mol. Its IUPAC name is N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6683185 |
| Molecular Formula | C37H35N7O4S |
| Molecular Weight | 673.80 g/mol |
| Exact Mass | 673.25 |
| IUPAC Name | N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
| SMILES | C[C@H]1[C@@H](CSc2nnnn2C)O[C@@H](c2ccc(-c3cccc(CNC(=O)c4cnc5ccccc5n4)c3)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C37H35N7O4S/c1-23-33(22-49-37-41-42-43-44(37)2)47-36(48-34(23)27-12-10-24(21-45)11-13-27)28-16-14-26(15-17-28)29-7-5-6-25(18-29)19-39-35(46)32-20-38-30-8-3-4-9-31(30)40-32/h3-18,20,23,33-34,36,45H,19,21-22H2,1-2H3,(H,39,46)/t23-,33+,34+,36+/m0/s1 |
| InChIKey | PSKCMAIIEWCKEI-JVLBCSTBSA-N |
| XLogP | 5.83 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.80 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |