C34H34N6O4S — CID 6683184
N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 6683184) has the molecular formula C34H34N6O4S and a molecular weight of 622.75 g/mol. Its IUPAC name is N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6683184 |
| Molecular Formula | C34H34N6O4S |
| Molecular Weight | 622.75 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | N-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CNC(=O)c4cccnc4)c3)cc2)O[C@@H]1CSc1nnnn1C |
| InChI | InChI=1S/C34H34N6O4S/c1-22-30(21-45-34-37-38-39-40(34)2)43-33(44-31(22)26-10-8-23(20-41)9-11-26)27-14-12-25(13-15-27)28-6-3-5-24(17-28)18-36-32(42)29-7-4-16-35-19-29/h3-17,19,22,30-31,33,41H,18,20-21H2,1-2H3,(H,36,42)/t22-,30+,31?,33+/m0/s1 |
| InChIKey | ZVHKSOLQPHNLRZ-JJUDITIFSA-N |
| XLogP | 5.28 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.75 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |