C33H32N6O4S — CID 6685804
N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 6685804) has the molecular formula C33H32N6O4S and a molecular weight of 608.72 g/mol. Its IUPAC name is N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6685804 |
| Molecular Formula | C33H32N6O4S |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(CNC(=O)c3cccnc3)cc2)O[C@@H]1CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C33H32N6O4S/c1-22-29(21-44-33-36-37-38-39(33)28-7-3-2-4-8-28)42-32(43-30(22)25-13-11-24(20-40)12-14-25)26-15-9-23(10-16-26)18-35-31(41)27-6-5-17-34-19-27/h2-17,19,22,29-30,32,40H,18,20-21H2,1H3,(H,35,41)/t22-,29+,30?,32+/m0/s1 |
| InChIKey | LBFRITPAWJUHQY-ZNCNIYHPSA-N |
| XLogP | 5.06 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |