C32H35N5O5S — CID 6688967
prop-2-enyl N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate (PubChem CID 6688967) has the molecular formula C32H35N5O5S and a molecular weight of 601.73 g/mol. Its IUPAC name is prop-2-enyl N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 6688967 |
| Molecular Formula | C32H35N5O5S |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | prop-2-enyl N-[[3-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methyltetrazol-5-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1cccc(-c2cccc([C@@H]3OC(c4ccc(CO)cc4)[C@H](C)[C@H](CSc4nnnn4C)O3)c2)c1 |
| InChI | InChI=1S/C32H35N5O5S/c1-4-15-40-32(39)33-18-23-7-5-8-25(16-23)26-9-6-10-27(17-26)30-41-28(20-43-31-34-35-36-37(31)3)21(2)29(42-30)24-13-11-22(19-38)12-14-24/h4-14,16-17,21,28-30,38H,1,15,18-20H2,2-3H3,(H,33,39)/t21-,28+,29?,30+/m1/s1 |
| InChIKey | FHRBISPRBIEQOL-XSJURACVSA-N |
| XLogP | 5.37 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|