C49H46N4O4 — CID 6686080
N-[[2-[4-[(2S,4S,5R,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide (PubChem CID 6686080) has the molecular formula C49H46N4O4 and a molecular weight of 754.93 g/mol. Its IUPAC name is N-[[2-[4-[(2S,4S,5R,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[2-[4-[(2S,4S,5R,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6686080 |
| Molecular Formula | C49H46N4O4 |
| Molecular Weight | 754.93 g/mol |
| Exact Mass | 754.35 |
| IUPAC Name | N-[[2-[4-[(2S,4S,5R,6R)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]quinoxaline-2-carboxamide |
| SMILES | C[C@H]1[C@@H](CN(Cc2ccccc2)Cc2ccccc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)c3cnc4ccccc4n3)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C49H46N4O4/c1-34-46(32-53(30-35-12-4-2-5-13-35)31-36-14-6-3-7-15-36)56-49(57-47(34)39-22-20-37(33-54)21-23-39)40-26-24-38(25-27-40)42-17-9-8-16-41(42)28-51-48(55)45-29-50-43-18-10-11-19-44(43)52-45/h2-27,29,34,46-47,49,54H,28,30-33H2,1H3,(H,51,55)/t34-,46+,47+,49+/m0/s1 |
| InChIKey | QINGZCJLZRGWFE-DPYHKNOYSA-N |
| XLogP | 9.21 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.93 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |