C44H46N2O6 — CID 6691829
4-[[2-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 6691829) has the molecular formula C44H46N2O6 and a molecular weight of 698.86 g/mol. Its IUPAC name is 4-[[2-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[2-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6691829 |
| Molecular Formula | C44H46N2O6 |
| Molecular Weight | 698.86 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | 4-[[2-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)CCC(=O)O)cc2)O[C@H]1CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C44H46N2O6/c1-31-40(29-46(27-32-10-4-2-5-11-32)28-33-12-6-3-7-13-33)51-44(52-43(31)36-18-16-34(30-47)17-19-36)37-22-20-35(21-23-37)39-15-9-8-14-38(39)26-45-41(48)24-25-42(49)50/h2-23,31,40,43-44,47H,24-30H2,1H3,(H,45,48)(H,49,50)/t31-,40+,43?,44+/m1/s1 |
| InChIKey | WBWJTVQXZQYFQB-WZCMJVAISA-N |
| XLogP | 7.82 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.86 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |