C41H37F5N2O4 — CID 6683435
N-[[2-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 6683435) has the molecular formula C41H37F5N2O4 and a molecular weight of 716.75 g/mol. Its IUPAC name is N-[[2-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[[2-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 6683435 |
| Molecular Formula | C41H37F5N2O4 |
| Molecular Weight | 716.75 g/mol |
| Exact Mass | 716.27 |
| IUPAC Name | N-[[2-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3ccccc3CNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O[C@@H]1CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C41H37F5N2O4/c1-24-32(22-48(2)21-25-8-4-3-5-9-25)51-41(52-39(24)28-14-12-26(23-49)13-15-28)29-18-16-27(17-19-29)31-11-7-6-10-30(31)20-47-40(50)33-34(42)36(44)38(46)37(45)35(33)43/h3-19,24,32,39,41,49H,20-23H2,1-2H3,(H,47,50)/t24-,32+,39?,41+/m0/s1 |
| InChIKey | FLPCTSBCSZZKEG-GIBCXVFRSA-N |
| XLogP | 8.39 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.75 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|