C31H42N2O6 — CID 6688428
5-[3-[(2R,4R,5S,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid (PubChem CID 6688428) has the molecular formula C31H42N2O6 and a molecular weight of 538.69 g/mol. Its IUPAC name is 5-[3-[(2R,4R,5S,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid.
| Compound Name | 5-[3-[(2R,4R,5S,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6688428 |
| Molecular Formula | C31H42N2O6 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | 5-[3-[(2R,4R,5S,6S)-4-(azocan-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-5-oxopentanoic acid |
| SMILES | C[C@@H]1[C@H](CN2CCCCCCC2)O[C@H](c2cccc(NC(=O)CCCC(=O)O)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C31H42N2O6/c1-22-27(20-33-17-5-3-2-4-6-18-33)38-31(39-30(22)24-15-13-23(21-34)14-16-24)25-9-7-10-26(19-25)32-28(35)11-8-12-29(36)37/h7,9-10,13-16,19,22,27,30-31,34H,2-6,8,11-12,17-18,20-21H2,1H3,(H,32,35)(H,36,37)/t22-,27+,30+,31+/m1/s1 |
| InChIKey | UBXFJSXXSKLBND-XISBPEQGSA-N |
| XLogP | 5.43 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |