C37H33Cl2N3O5 — CID 6680920
N-(3-acetylphenyl)-2-[4-[(4S,5S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6680920) has the molecular formula C37H33Cl2N3O5 and a molecular weight of 670.59 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[4-[(4S,5S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[4-[(4S,5S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6680920 |
| Molecular Formula | C37H33Cl2N3O5 |
| Molecular Weight | 670.59 g/mol |
| Exact Mass | 669.18 |
| IUPAC Name | N-(3-acetylphenyl)-2-[4-[(4S,5S,6R)-4-[(4,5-dichloroimidazol-1-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-5-phenyl-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)Cc2ccc(C3O[C@H](Cn4cnc(Cl)c4Cl)[C@@H](c4ccccc4)[C@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C37H33Cl2N3O5/c1-23(44)29-8-5-9-30(19-29)41-32(45)18-24-10-16-28(17-11-24)37-46-31(20-42-22-40-35(38)36(42)39)33(26-6-3-2-4-7-26)34(47-37)27-14-12-25(21-43)13-15-27/h2-17,19,22,31,33-34,37,43H,18,20-21H2,1H3,(H,41,45)/t31-,33-,34+,37?/m1/s1 |
| InChIKey | VSGXRCDBUDXEBI-JFMDJFEUSA-N |
| XLogP | 7.71 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.59 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |