C31H29N3O3 — CID 5197160
[4-[2-(3-aminophenyl)-6-(benzimidazol-1-ylmethyl)-5-phenyl-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 5197160) has the molecular formula C31H29N3O3 and a molecular weight of 491.59 g/mol. Its IUPAC name is [4-[2-(3-aminophenyl)-6-(benzimidazol-1-ylmethyl)-5-phenyl-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[2-(3-aminophenyl)-6-(benzimidazol-1-ylmethyl)-5-phenyl-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 5197160 |
| Molecular Formula | C31H29N3O3 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | [4-[2-(3-aminophenyl)-6-(benzimidazol-1-ylmethyl)-5-phenyl-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | Nc1cccc(C2OC(Cn3cnc4ccccc43)C(c3ccccc3)C(c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C31H29N3O3/c32-25-10-6-9-24(17-25)31-36-28(18-34-20-33-26-11-4-5-12-27(26)34)29(22-7-2-1-3-8-22)30(37-31)23-15-13-21(19-35)14-16-23/h1-17,20,28-31,35H,18-19,32H2 |
| InChIKey | WBYYJFGADWHXBT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|