C35H38N4O6 — CID 6684289
N-[3-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide (PubChem CID 6684289) has the molecular formula C35H38N4O6 and a molecular weight of 610.71 g/mol. Its IUPAC name is N-[3-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide.
| Compound Name | N-[3-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6684289 |
| Molecular Formula | C35H38N4O6 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | N-[3-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]quinoxaline-2-carboxamide |
| SMILES | C[C@H]1[C@@H](CN2CCC3(CC2)OCCO3)O[C@@H](c2cccc(NC(=O)c3cnc4ccccc4n3)c2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H38N4O6/c1-23-31(21-39-15-13-35(14-16-39)42-17-18-43-35)44-34(45-32(23)25-11-9-24(22-40)10-12-25)26-5-4-6-27(19-26)37-33(41)30-20-36-28-7-2-3-8-29(28)38-30/h2-12,19-20,23,31-32,34,40H,13-18,21-22H2,1H3,(H,37,41)/t23-,31+,32+,34+/m0/s1 |
| InChIKey | IZZJUSRYRVQFQW-JGNUWMRCSA-N |
| XLogP | 5.00 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |