C38H39Cl3N4O6 — CID 4166985
2,2,2-trichloro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 4166985) has the molecular formula C38H39Cl3N4O6 and a molecular weight of 754.11 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 4166985 |
| Molecular Formula | C38H39Cl3N4O6 |
| Molecular Weight | 754.11 g/mol |
| Exact Mass | 752.19 |
| IUPAC Name | 2,2,2-trichloro-N-[[2-[4-[4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | CC1C(CN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)OC(c2ccc(-c3ccccc3CNC(=O)C(Cl)(Cl)Cl)cc2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C38H39Cl3N4O6/c1-25-34(23-43-18-20-44(21-19-43)31-14-16-32(17-15-31)45(48)49)50-36(51-35(25)28-8-6-26(24-46)7-9-28)29-12-10-27(11-13-29)33-5-3-2-4-30(33)22-42-37(47)38(39,40)41/h2-17,25,34-36,46H,18-24H2,1H3,(H,42,47) |
| InChIKey | OHJLANVACRHFPF-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.11 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|